C30H42ClNO9S — CID 176648918
methyl (2R,4S,5R,6R)-6-[(1R,2R)-3-[[2-(4-chlorophenyl)acetyl]amino]-1,2-dihydroxypropyl]-4-hydroxy-2-(6-prop-2-ynoxyhexoxy)-5-(2-sulfanylidenepropyl)oxane-2-carboxylate (PubChem CID 176648918) has the molecular formula C30H42ClNO9S and a molecular weight of 628.18 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-6-[(1R,2R)-3-[[2-(4-chlorophenyl)acetyl]amino]-1,2-dihydroxypropyl]-4-hydroxy-2-(6-prop-2-ynoxyhexoxy)-5-(2-sulfanylidenepropyl)oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-6-[(1R,2R)-3-[[2-(4-chlorophenyl)acetyl]amino]-1,2-dihydroxypropyl]-4-hydroxy-2-(6-prop-2-ynoxyhexoxy)-5-(2-sulfanylidenepropyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 176648918 |
| Molecular Formula | C30H42ClNO9S |
| Molecular Weight | 628.18 g/mol |
| Exact Mass | 627.23 |
| IUPAC Name | methyl (2R,4S,5R,6R)-6-[(1R,2R)-3-[[2-(4-chlorophenyl)acetyl]amino]-1,2-dihydroxypropyl]-4-hydroxy-2-(6-prop-2-ynoxyhexoxy)-5-(2-sulfanylidenepropyl)oxane-2-carboxylate |
| SMILES | C#CCOCCCCCCO[C@]1(C(=O)OC)C[C@H](O)[C@@H](CC(C)=S)[C@H]([C@H](O)[C@H](O)CNC(=O)Cc2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C30H42ClNO9S/c1-4-13-39-14-7-5-6-8-15-40-30(29(37)38-3)18-24(33)23(16-20(2)42)28(41-30)27(36)25(34)19-32-26(35)17-21-9-11-22(31)12-10-21/h1,9-12,23-25,27-28,33-34,36H,5-8,13-19H2,2-3H3,(H,32,35)/t23-,24+,25-,27-,28-,30-/m1/s1 |
| InChIKey | QUGDUVKYWRNWDE-HZCVYACOSA-N |
| XLogP | 2.36 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.18 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|