C35H47NO9 — CID 176972960
(2R,6R)-6-[(1R)-3-[[2-(4-dec-9-ynoxyphenyl)acetyl]amino]-1,2-dihydroxypropyl]-5-(hydroxymethyl)-2-phenylmethoxyoxane-2-carboxylic acid (PubChem CID 176972960) has the molecular formula C35H47NO9 and a molecular weight of 625.76 g/mol. Its IUPAC name is (2R,6R)-6-[(1R)-3-[[2-(4-dec-9-ynoxyphenyl)acetyl]amino]-1,2-dihydroxypropyl]-5-(hydroxymethyl)-2-phenylmethoxyoxane-2-carboxylic acid.
| Compound Name | (2R,6R)-6-[(1R)-3-[[2-(4-dec-9-ynoxyphenyl)acetyl]amino]-1,2-dihydroxypropyl]-5-(hydroxymethyl)-2-phenylmethoxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 176972960 |
| Molecular Formula | C35H47NO9 |
| Molecular Weight | 625.76 g/mol |
| Exact Mass | 625.33 |
| IUPAC Name | (2R,6R)-6-[(1R)-3-[[2-(4-dec-9-ynoxyphenyl)acetyl]amino]-1,2-dihydroxypropyl]-5-(hydroxymethyl)-2-phenylmethoxyoxane-2-carboxylic acid |
| SMILES | C#CCCCCCCCCOc1ccc(CC(=O)NCC(O)[C@@H](O)[C@@H]2O[C@@](OCc3ccccc3)(C(=O)O)CCC2CO)cc1 |
| InChI | InChI=1S/C35H47NO9/c1-2-3-4-5-6-7-8-12-21-43-29-17-15-26(16-18-29)22-31(39)36-23-30(38)32(40)33-28(24-37)19-20-35(45-33,34(41)42)44-25-27-13-10-9-11-14-27/h1,9-11,13-18,28,30,32-33,37-38,40H,3-8,12,19-25H2,(H,36,39)(H,41,42)/t28?,30?,32-,33-,35-/m1/s1 |
| InChIKey | MARPLMLSUWVKNQ-OQAPHURKSA-N |
| XLogP | 3.60 |
| TPSA | 154.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|