C26H36N4O11 — CID 177122458
(2R,4S,5R,6R)-6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-2-phenylmethoxy-5-[3-[2-(2-prop-2-ynoxyethoxy)ethoxy]propanoylamino]oxane-2-carboxylic acid (PubChem CID 177122458) has the molecular formula C26H36N4O11 and a molecular weight of 580.59 g/mol. Its IUPAC name is (2R,4S,5R,6R)-6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-2-phenylmethoxy-5-[3-[2-(2-prop-2-ynoxyethoxy)ethoxy]propanoylamino]oxane-2-carboxylic acid.
| Compound Name | (2R,4S,5R,6R)-6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-2-phenylmethoxy-5-[3-[2-(2-prop-2-ynoxyethoxy)ethoxy]propanoylamino]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 177122458 |
| Molecular Formula | C26H36N4O11 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | (2R,4S,5R,6R)-6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-2-phenylmethoxy-5-[3-[2-(2-prop-2-ynoxyethoxy)ethoxy]propanoylamino]oxane-2-carboxylic acid |
| SMILES | C#CCOCCOCCOCCC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CN=[N+]=[N-])O[C@@](OCc2ccccc2)(C(=O)O)C[C@@H]1O |
| InChI | InChI=1S/C26H36N4O11/c1-2-9-37-11-13-39-14-12-38-10-8-21(33)29-22-19(31)15-26(25(35)36,40-17-18-6-4-3-5-7-18)41-24(22)23(34)20(32)16-28-30-27/h1,3-7,19-20,22-24,31-32,34H,8-17H2,(H,29,33)(H,35,36)/t19-,20+,22+,23+,24+,26+/m0/s1 |
| InChIKey | MSLMOPOQUNXHAF-YJGXBXLCSA-N |
| XLogP | -0.28 |
| TPSA | 222.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|