C18H24N2O6 — CID 176655327
1-[4-[3-(2,5-dihydroxypyrrolidin-1-yl)-3-hydroxypropyl]-3-methoxyphenyl]pyrrolidine-2,5-dione (PubChem CID 176655327) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is 1-[4-[3-(2,5-dihydroxypyrrolidin-1-yl)-3-hydroxypropyl]-3-methoxyphenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[3-(2,5-dihydroxypyrrolidin-1-yl)-3-hydroxypropyl]-3-methoxyphenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 176655327 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-[4-[3-(2,5-dihydroxypyrrolidin-1-yl)-3-hydroxypropyl]-3-methoxyphenyl]pyrrolidine-2,5-dione |
| SMILES | COc1cc(N2C(=O)CCC2=O)ccc1CCC(O)N1C(O)CCC1O |
| InChI | InChI=1S/C18H24N2O6/c1-26-13-10-12(19-14(21)6-7-15(19)22)4-2-11(13)3-5-16(23)20-17(24)8-9-18(20)25/h2,4,10,16-18,23-25H,3,5-9H2,1H3 |
| InChIKey | IZHHUIABENYKKI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|