C17H26FN3O2 — CID 176657796
N-[2-[3-(dimethylamino)propanimidoyl]-5-fluoro-4-methoxyphenyl]oxan-2-amine (PubChem CID 176657796) has the molecular formula C17H26FN3O2 and a molecular weight of 323.41 g/mol. Its IUPAC name is N-[2-[3-(dimethylamino)propanimidoyl]-5-fluoro-4-methoxyphenyl]oxan-2-amine.
| Compound Name | N-[2-[3-(dimethylamino)propanimidoyl]-5-fluoro-4-methoxyphenyl]oxan-2-amine |
|---|---|
| PubChem CID | 176657796 |
| Molecular Formula | C17H26FN3O2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-[2-[3-(dimethylamino)propanimidoyl]-5-fluoro-4-methoxyphenyl]oxan-2-amine |
| SMILES | [H]/N=C(\CCN(C)C)c1cc(OC)c(F)cc1NC1CCCCO1 |
| InChI | InChI=1S/C17H26FN3O2/c1-21(2)8-7-14(19)12-10-16(22-3)13(18)11-15(12)20-17-6-4-5-9-23-17/h10-11,17,19-20H,4-9H2,1-3H3/b19-14+ |
| InChIKey | CZCALLQMVHFRRF-XMHGGMMESA-N |
| XLogP | 3.09 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|