C31H35N3O6 — CID 176658165
tert-butyl 4-[[4-[(4-aminobenzoyl)amino]-3-propan-2-yloxy-2-prop-2-enoxybenzoyl]amino]benzoate (PubChem CID 176658165) has the molecular formula C31H35N3O6 and a molecular weight of 545.64 g/mol. Its IUPAC name is tert-butyl 4-[[4-[(4-aminobenzoyl)amino]-3-propan-2-yloxy-2-prop-2-enoxybenzoyl]amino]benzoate.
| Compound Name | tert-butyl 4-[[4-[(4-aminobenzoyl)amino]-3-propan-2-yloxy-2-prop-2-enoxybenzoyl]amino]benzoate |
|---|---|
| PubChem CID | 176658165 |
| Molecular Formula | C31H35N3O6 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | tert-butyl 4-[[4-[(4-aminobenzoyl)amino]-3-propan-2-yloxy-2-prop-2-enoxybenzoyl]amino]benzoate |
| SMILES | C=CCOc1c(C(=O)Nc2ccc(C(=O)OC(C)(C)C)cc2)ccc(NC(=O)c2ccc(N)cc2)c1OC(C)C |
| InChI | InChI=1S/C31H35N3O6/c1-7-18-38-26-24(29(36)33-23-14-10-21(11-15-23)30(37)40-31(4,5)6)16-17-25(27(26)39-19(2)3)34-28(35)20-8-12-22(32)13-9-20/h7-17,19H,1,18,32H2,2-6H3,(H,33,36)(H,34,35) |
| InChIKey | KIYXIHKFPDJBFX-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|