C39H40N4O6 — CID 161109545
4-[[4-[[4-(4-aminophenyl)-4-oxobutanoyl]amino]benzoyl]amino]-N-(2,4-dimethyl-3-prop-2-enoxyphenyl)-3-methyl-2-prop-2-enoxybenzamide (PubChem CID 161109545) has the molecular formula C39H40N4O6 and a molecular weight of 660.77 g/mol. Its IUPAC name is 4-[[4-[[4-(4-aminophenyl)-4-oxobutanoyl]amino]benzoyl]amino]-N-(2,4-dimethyl-3-prop-2-enoxyphenyl)-3-methyl-2-prop-2-enoxybenzamide.
| Compound Name | 4-[[4-[[4-(4-aminophenyl)-4-oxobutanoyl]amino]benzoyl]amino]-N-(2,4-dimethyl-3-prop-2-enoxyphenyl)-3-methyl-2-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 161109545 |
| Molecular Formula | C39H40N4O6 |
| Molecular Weight | 660.77 g/mol |
| Exact Mass | 660.29 |
| IUPAC Name | 4-[[4-[[4-(4-aminophenyl)-4-oxobutanoyl]amino]benzoyl]amino]-N-(2,4-dimethyl-3-prop-2-enoxyphenyl)-3-methyl-2-prop-2-enoxybenzamide |
| SMILES | C=CCOc1c(C)ccc(NC(=O)c2ccc(NC(=O)c3ccc(NC(=O)CCC(=O)c4ccc(N)cc4)cc3)c(C)c2OCC=C)c1C |
| InChI | InChI=1S/C39H40N4O6/c1-6-22-48-36-24(3)8-18-32(25(36)4)43-39(47)31-17-19-33(26(5)37(31)49-23-7-2)42-38(46)28-11-15-30(16-12-28)41-35(45)21-20-34(44)27-9-13-29(40)14-10-27/h6-19H,1-2,20-23,40H2,3-5H3,(H,41,45)(H,42,46)(H,43,47) |
| InChIKey | HIKILCFCZVQJOT-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.77 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|