C32H33N3O8 — CID 90344663
prop-2-enyl 4-[[4-[(4-aminobenzoyl)amino]-3-methoxy-2-prop-2-enoxybenzoyl]amino]-3-methoxy-2-prop-2-enoxybenzoate (PubChem CID 90344663) has the molecular formula C32H33N3O8 and a molecular weight of 587.63 g/mol. Its IUPAC name is prop-2-enyl 4-[[4-[(4-aminobenzoyl)amino]-3-methoxy-2-prop-2-enoxybenzoyl]amino]-3-methoxy-2-prop-2-enoxybenzoate.
| Compound Name | prop-2-enyl 4-[[4-[(4-aminobenzoyl)amino]-3-methoxy-2-prop-2-enoxybenzoyl]amino]-3-methoxy-2-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 90344663 |
| Molecular Formula | C32H33N3O8 |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | prop-2-enyl 4-[[4-[(4-aminobenzoyl)amino]-3-methoxy-2-prop-2-enoxybenzoyl]amino]-3-methoxy-2-prop-2-enoxybenzoate |
| SMILES | C=CCOC(=O)c1ccc(NC(=O)c2ccc(NC(=O)c3ccc(N)cc3)c(OC)c2OCC=C)c(OC)c1OCC=C |
| InChI | InChI=1S/C32H33N3O8/c1-6-17-41-26-22(13-15-24(28(26)39-4)34-30(36)20-9-11-21(33)12-10-20)31(37)35-25-16-14-23(32(38)43-19-8-3)27(29(25)40-5)42-18-7-2/h6-16H,1-3,17-19,33H2,4-5H3,(H,34,36)(H,35,37) |
| InChIKey | ZPABPJYCFSRVDV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 147.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|