C23H24N2O5 — CID 153496258
prop-2-enyl 4-[(4-amino-2-prop-2-enoxybenzoyl)amino]-2-prop-2-enoxybenzoate (PubChem CID 153496258) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is prop-2-enyl 4-[(4-amino-2-prop-2-enoxybenzoyl)amino]-2-prop-2-enoxybenzoate.
| Compound Name | prop-2-enyl 4-[(4-amino-2-prop-2-enoxybenzoyl)amino]-2-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 153496258 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | prop-2-enyl 4-[(4-amino-2-prop-2-enoxybenzoyl)amino]-2-prop-2-enoxybenzoate |
| SMILES | C=CCOC(=O)c1ccc(NC(=O)c2ccc(N)cc2OCC=C)cc1OCC=C |
| InChI | InChI=1S/C23H24N2O5/c1-4-11-28-20-14-16(24)7-9-18(20)22(26)25-17-8-10-19(23(27)30-13-6-3)21(15-17)29-12-5-2/h4-10,14-15H,1-3,11-13,24H2,(H,25,26) |
| InChIKey | WJWSULLEULTGMD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|