C21H25N5O4S — CID 176659586
N-[4-amino-5-(2-methylsulfanylethyliminomethyl)-2-morpholin-4-ylphenyl]-3-nitrobenzamide (PubChem CID 176659586) has the molecular formula C21H25N5O4S and a molecular weight of 443.53 g/mol. Its IUPAC name is N-[4-amino-5-(2-methylsulfanylethyliminomethyl)-2-morpholin-4-ylphenyl]-3-nitrobenzamide.
| Compound Name | N-[4-amino-5-(2-methylsulfanylethyliminomethyl)-2-morpholin-4-ylphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 176659586 |
| Molecular Formula | C21H25N5O4S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | N-[4-amino-5-(2-methylsulfanylethyliminomethyl)-2-morpholin-4-ylphenyl]-3-nitrobenzamide |
| SMILES | CSCC/N=C/c1cc(NC(=O)c2cccc([N+](=O)[O-])c2)c(N2CCOCC2)cc1N |
| InChI | InChI=1S/C21H25N5O4S/c1-31-10-5-23-14-16-12-19(20(13-18(16)22)25-6-8-30-9-7-25)24-21(27)15-3-2-4-17(11-15)26(28)29/h2-4,11-14H,5-10,22H2,1H3,(H,24,27)/b23-14+ |
| InChIKey | OLGCZGRNFLMJCV-OEAKJJBVSA-N |
| XLogP | 3.05 |
| TPSA | 123.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|