C26H26FN5O4 — CID 176659618
N-[4-amino-2-(4-fluorophenyl)-5-(2-morpholin-4-ylethyliminomethyl)phenyl]-3-nitrobenzamide (PubChem CID 176659618) has the molecular formula C26H26FN5O4 and a molecular weight of 491.52 g/mol. Its IUPAC name is N-[4-amino-2-(4-fluorophenyl)-5-(2-morpholin-4-ylethyliminomethyl)phenyl]-3-nitrobenzamide.
| Compound Name | N-[4-amino-2-(4-fluorophenyl)-5-(2-morpholin-4-ylethyliminomethyl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 176659618 |
| Molecular Formula | C26H26FN5O4 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | N-[4-amino-2-(4-fluorophenyl)-5-(2-morpholin-4-ylethyliminomethyl)phenyl]-3-nitrobenzamide |
| SMILES | Nc1cc(-c2ccc(F)cc2)c(NC(=O)c2cccc([N+](=O)[O-])c2)cc1/C=N/CCN1CCOCC1 |
| InChI | InChI=1S/C26H26FN5O4/c27-21-6-4-18(5-7-21)23-16-24(28)20(17-29-8-9-31-10-12-36-13-11-31)15-25(23)30-26(33)19-2-1-3-22(14-19)32(34)35/h1-7,14-17H,8-13,28H2,(H,30,33)/b29-17+ |
| InChIKey | IJVUMEPHHGRSGV-STBIYBPSSA-N |
| XLogP | 3.99 |
| TPSA | 123.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|