C29H33N5O5 — CID 176659573
N-[4-amino-5-[(3-hydroxy-3-methylbutyl)iminomethyl]-2-(4-morpholin-4-ylphenyl)phenyl]-3-nitrobenzamide (PubChem CID 176659573) has the molecular formula C29H33N5O5 and a molecular weight of 531.61 g/mol. Its IUPAC name is N-[4-amino-5-[(3-hydroxy-3-methylbutyl)iminomethyl]-2-(4-morpholin-4-ylphenyl)phenyl]-3-nitrobenzamide.
| Compound Name | N-[4-amino-5-[(3-hydroxy-3-methylbutyl)iminomethyl]-2-(4-morpholin-4-ylphenyl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 176659573 |
| Molecular Formula | C29H33N5O5 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | N-[4-amino-5-[(3-hydroxy-3-methylbutyl)iminomethyl]-2-(4-morpholin-4-ylphenyl)phenyl]-3-nitrobenzamide |
| SMILES | CC(C)(O)CC/N=C/c1cc(NC(=O)c2cccc([N+](=O)[O-])c2)c(-c2ccc(N3CCOCC3)cc2)cc1N |
| InChI | InChI=1S/C29H33N5O5/c1-29(2,36)10-11-31-19-22-17-27(32-28(35)21-4-3-5-24(16-21)34(37)38)25(18-26(22)30)20-6-8-23(9-7-20)33-12-14-39-15-13-33/h3-9,16-19,36H,10-15,30H2,1-2H3,(H,32,35)/b31-19+ |
| InChIKey | CQECRWODNOGXQS-ZCTHSVRISA-N |
| XLogP | 4.51 |
| TPSA | 143.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|