C25H27N5O3S — CID 176659480
N-[4-amino-2-(furan-3-yl)-5-[(3-hydroxy-3-methylbutyl)iminomethyl]phenyl]-2-(3,4-dihydropyridin-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 176659480) has the molecular formula C25H27N5O3S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-[4-amino-2-(furan-3-yl)-5-[(3-hydroxy-3-methylbutyl)iminomethyl]phenyl]-2-(3,4-dihydropyridin-4-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-amino-2-(furan-3-yl)-5-[(3-hydroxy-3-methylbutyl)iminomethyl]phenyl]-2-(3,4-dihydropyridin-4-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 176659480 |
| Molecular Formula | C25H27N5O3S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-[4-amino-2-(furan-3-yl)-5-[(3-hydroxy-3-methylbutyl)iminomethyl]phenyl]-2-(3,4-dihydropyridin-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)(O)CC/N=C/c1cc(NC(=O)c2csc(C3C=CN=CC3)n2)c(-c2ccoc2)cc1N |
| InChI | InChI=1S/C25H27N5O3S/c1-25(2,32)6-9-28-13-18-11-21(19(12-20(18)26)17-5-10-33-14-17)29-23(31)22-15-34-24(30-22)16-3-7-27-8-4-16/h3,5,7-8,10-16,32H,4,6,9,26H2,1-2H3,(H,29,31)/b28-13+ |
| InChIKey | CCTRSKRDRDPNJC-XODNFHPESA-N |
| XLogP | 4.89 |
| TPSA | 126.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|