C23H23N5O4S — CID 176659407
N-[4-amino-2-(furan-3-yl)-5-[(3-hydroxy-3-methylbutyl)iminomethyl]phenyl]-2-(1,3-oxazol-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 176659407) has the molecular formula C23H23N5O4S and a molecular weight of 465.54 g/mol. Its IUPAC name is N-[4-amino-2-(furan-3-yl)-5-[(3-hydroxy-3-methylbutyl)iminomethyl]phenyl]-2-(1,3-oxazol-4-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-amino-2-(furan-3-yl)-5-[(3-hydroxy-3-methylbutyl)iminomethyl]phenyl]-2-(1,3-oxazol-4-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 176659407 |
| Molecular Formula | C23H23N5O4S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-[4-amino-2-(furan-3-yl)-5-[(3-hydroxy-3-methylbutyl)iminomethyl]phenyl]-2-(1,3-oxazol-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)(O)CC/N=C/c1cc(NC(=O)c2csc(-c3cocn3)n2)c(-c2ccoc2)cc1N |
| InChI | InChI=1S/C23H23N5O4S/c1-23(2,30)4-5-25-9-15-7-18(16(8-17(15)24)14-3-6-31-10-14)27-21(29)20-12-33-22(28-20)19-11-32-13-26-19/h3,6-13,30H,4-5,24H2,1-2H3,(H,27,29)/b25-9+ |
| InChIKey | YSGSOXLDMBSNML-YCPBAFNGSA-N |
| XLogP | 4.47 |
| TPSA | 139.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|