C26H27N5O3S — CID 176659455
N-[4-amino-2-(furan-3-yl)-5-[(3-hydroxy-3-methylbutyl)iminomethyl]phenyl]-2-(6-methyl-3-pyridinyl)-1,3-thiazole-4-carboxamide (PubChem CID 176659455) has the molecular formula C26H27N5O3S and a molecular weight of 489.60 g/mol. Its IUPAC name is N-[4-amino-2-(furan-3-yl)-5-[(3-hydroxy-3-methylbutyl)iminomethyl]phenyl]-2-(6-methyl-3-pyridinyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-amino-2-(furan-3-yl)-5-[(3-hydroxy-3-methylbutyl)iminomethyl]phenyl]-2-(6-methyl-3-pyridinyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 176659455 |
| Molecular Formula | C26H27N5O3S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | N-[4-amino-2-(furan-3-yl)-5-[(3-hydroxy-3-methylbutyl)iminomethyl]phenyl]-2-(6-methyl-3-pyridinyl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccc(-c2nc(C(=O)Nc3cc(/C=N/CCC(C)(C)O)c(N)cc3-c3ccoc3)cs2)cn1 |
| InChI | InChI=1S/C26H27N5O3S/c1-16-4-5-17(13-29-16)25-31-23(15-35-25)24(32)30-22-10-19(12-28-8-7-26(2,3)33)21(27)11-20(22)18-6-9-34-14-18/h4-6,9-15,33H,7-8,27H2,1-3H3,(H,30,32)/b28-12+ |
| InChIKey | KPYQLMVNHIPXSS-KVSWJAHQSA-N |
| XLogP | 5.19 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|