C23H26N8OS — CID 176659394
N-[4-amino-2-[(Z)-1-amino-3-iminoprop-1-enyl]-5-[2-(dimethylamino)ethyliminomethyl]phenyl]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide (PubChem CID 176659394) has the molecular formula C23H26N8OS and a molecular weight of 462.58 g/mol. Its IUPAC name is N-[4-amino-2-[(Z)-1-amino-3-iminoprop-1-enyl]-5-[2-(dimethylamino)ethyliminomethyl]phenyl]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-amino-2-[(Z)-1-amino-3-iminoprop-1-enyl]-5-[2-(dimethylamino)ethyliminomethyl]phenyl]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 176659394 |
| Molecular Formula | C23H26N8OS |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | N-[4-amino-2-[(Z)-1-amino-3-iminoprop-1-enyl]-5-[2-(dimethylamino)ethyliminomethyl]phenyl]-2-pyridin-4-yl-1,3-thiazole-4-carboxamide |
| SMILES | [H]/N=C/C=C(\N)c1cc(N)c(/C=N/CCN(C)C)cc1NC(=O)c1csc(-c2ccncc2)n1 |
| InChI | InChI=1S/C23H26N8OS/c1-31(2)10-9-28-13-16-11-20(17(12-19(16)26)18(25)3-6-24)29-22(32)21-14-33-23(30-21)15-4-7-27-8-5-15/h3-8,11-14,24H,9-10,25-26H2,1-2H3,(H,29,32)/b18-3-,24-6+,28-13+ |
| InChIKey | OFBVFFBCZJDUEM-CJPVDERLSA-N |
| XLogP | 2.97 |
| TPSA | 146.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|