C9H6N3O2S- — CID 88725895
N-oxido-2-pyridin-4-yl-1,3-thiazole-4-carboxamide (PubChem CID 88725895) has the molecular formula C9H6N3O2S- and a molecular weight of 220.23 g/mol. Its IUPAC name is N-oxido-2-pyridin-4-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-oxido-2-pyridin-4-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 88725895 |
| Molecular Formula | C9H6N3O2S- |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | N-oxido-2-pyridin-4-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(N[O-])c1csc(-c2ccncc2)n1 |
| InChI | InChI=1S/C9H6N3O2S/c13-8(12-14)7-5-15-9(11-7)6-1-3-10-4-2-6/h1-5H,(H-,10,11,12,13,14)/q-1 |
| InChIKey | XSOZZJUBZUGDIV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|