C9H7N3O2S — CID 88725894
oxido-(2-pyridin-4-yl-1,3-thiazole-4-carbonyl)azanium (PubChem CID 88725894) has the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. Its IUPAC name is oxido-(2-pyridin-4-yl-1,3-thiazole-4-carbonyl)azanium.
| Compound Name | oxido-(2-pyridin-4-yl-1,3-thiazole-4-carbonyl)azanium |
|---|---|
| PubChem CID | 88725894 |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | oxido-(2-pyridin-4-yl-1,3-thiazole-4-carbonyl)azanium |
| SMILES | O=C([NH2+][O-])c1csc(-c2ccncc2)n1 |
| InChI | InChI=1S/C9H7N3O2S/c13-8(12-14)7-5-15-9(11-7)6-1-3-10-4-2-6/h1-5H,12H2 |
| InChIKey | HQXWCZLPXFXOCQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 82.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|