C23H19FN6O3S — CID 176659508
N-[4-amino-5-[(3-amino-3-oxopropyl)iminomethyl]-2-(furan-3-yl)phenyl]-2-(6-fluoro-3-pyridinyl)-1,3-thiazole-4-carboxamide (PubChem CID 176659508) has the molecular formula C23H19FN6O3S and a molecular weight of 478.51 g/mol. Its IUPAC name is N-[4-amino-5-[(3-amino-3-oxopropyl)iminomethyl]-2-(furan-3-yl)phenyl]-2-(6-fluoro-3-pyridinyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-amino-5-[(3-amino-3-oxopropyl)iminomethyl]-2-(furan-3-yl)phenyl]-2-(6-fluoro-3-pyridinyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 176659508 |
| Molecular Formula | C23H19FN6O3S |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | N-[4-amino-5-[(3-amino-3-oxopropyl)iminomethyl]-2-(furan-3-yl)phenyl]-2-(6-fluoro-3-pyridinyl)-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)CC/N=C/c1cc(NC(=O)c2csc(-c3ccc(F)nc3)n2)c(-c2ccoc2)cc1N |
| InChI | InChI=1S/C23H19FN6O3S/c24-20-2-1-13(10-28-20)23-30-19(12-34-23)22(32)29-18-7-15(9-27-5-3-21(26)31)17(25)8-16(18)14-4-6-33-11-14/h1-2,4,6-12H,3,5,25H2,(H2,26,31)(H,29,32)/b27-9+ |
| InChIKey | LMVGGJBWKFVMJL-OXUBWTJQSA-N |
| XLogP | 3.73 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|