C25H26N6O3S — CID 176659505
N-[4-amino-3-(furan-3-yl)-5-[(3-hydroxy-3-methylbutyl)iminomethyl]phenyl]-2-(2-amino-4-pyridinyl)-1,3-thiazole-4-carboxamide (PubChem CID 176659505) has the molecular formula C25H26N6O3S and a molecular weight of 490.59 g/mol. Its IUPAC name is N-[4-amino-3-(furan-3-yl)-5-[(3-hydroxy-3-methylbutyl)iminomethyl]phenyl]-2-(2-amino-4-pyridinyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-amino-3-(furan-3-yl)-5-[(3-hydroxy-3-methylbutyl)iminomethyl]phenyl]-2-(2-amino-4-pyridinyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 176659505 |
| Molecular Formula | C25H26N6O3S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | N-[4-amino-3-(furan-3-yl)-5-[(3-hydroxy-3-methylbutyl)iminomethyl]phenyl]-2-(2-amino-4-pyridinyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)(O)CC/N=C/c1cc(NC(=O)c2csc(-c3ccnc(N)c3)n2)cc(-c2ccoc2)c1N |
| InChI | InChI=1S/C25H26N6O3S/c1-25(2,33)5-7-28-12-17-9-18(11-19(22(17)27)16-4-8-34-13-16)30-23(32)20-14-35-24(31-20)15-3-6-29-21(26)10-15/h3-4,6,8-14,33H,5,7,27H2,1-2H3,(H2,26,29)(H,30,32)/b28-12+ |
| InChIKey | AJMYSZBEZSMIIP-KVSWJAHQSA-N |
| XLogP | 4.46 |
| TPSA | 152.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|