C33H38N4O5 — CID 176659607
N-[2-(3-hydroxy-3-methylbutyl)-3-methyl-7-(4-morpholin-4-ylphenyl)-3,4-dihydro-2-benzazepin-8-yl]-3-nitrobenzamide (PubChem CID 176659607) has the molecular formula C33H38N4O5 and a molecular weight of 570.69 g/mol. Its IUPAC name is N-[2-(3-hydroxy-3-methylbutyl)-3-methyl-7-(4-morpholin-4-ylphenyl)-3,4-dihydro-2-benzazepin-8-yl]-3-nitrobenzamide.
| Compound Name | N-[2-(3-hydroxy-3-methylbutyl)-3-methyl-7-(4-morpholin-4-ylphenyl)-3,4-dihydro-2-benzazepin-8-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 176659607 |
| Molecular Formula | C33H38N4O5 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | N-[2-(3-hydroxy-3-methylbutyl)-3-methyl-7-(4-morpholin-4-ylphenyl)-3,4-dihydro-2-benzazepin-8-yl]-3-nitrobenzamide |
| SMILES | CC1CC=c2cc(-c3ccc(N4CCOCC4)cc3)c(NC(=O)c3cccc([N+](=O)[O-])c3)cc2=CN1CCC(C)(C)O |
| InChI | InChI=1S/C33H38N4O5/c1-23-7-8-25-20-30(24-9-11-28(12-10-24)35-15-17-42-18-16-35)31(21-27(25)22-36(23)14-13-33(2,3)39)34-32(38)26-5-4-6-29(19-26)37(40)41/h4-6,8-12,19-23,39H,7,13-18H2,1-3H3,(H,34,38) |
| InChIKey | NQMDPWBENLDESV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 108.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|