C11H9BrF5NO2 — CID 176659769
2-bromo-N-[2,2-difluoro-2-[3-(trifluoromethoxy)phenyl]ethyl]acetamide (PubChem CID 176659769) has the molecular formula C11H9BrF5NO2 and a molecular weight of 362.09 g/mol. Its IUPAC name is 2-bromo-N-[2,2-difluoro-2-[3-(trifluoromethoxy)phenyl]ethyl]acetamide.
| Compound Name | 2-bromo-N-[2,2-difluoro-2-[3-(trifluoromethoxy)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 176659769 |
| Molecular Formula | C11H9BrF5NO2 |
| Molecular Weight | 362.09 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 2-bromo-N-[2,2-difluoro-2-[3-(trifluoromethoxy)phenyl]ethyl]acetamide |
| SMILES | O=C(CBr)NCC(F)(F)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C11H9BrF5NO2/c12-5-9(19)18-6-10(13,14)7-2-1-3-8(4-7)20-11(15,16)17/h1-4H,5-6H2,(H,18,19) |
| InChIKey | OQNUQSHNPVQKKQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.09 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|