C28H37BBrN3O6 — CID 176661744
[(R)-[[(2S)-2-[[(2S)-3-(3-bromophenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-4-methylpentanoyl]amino]-cyclobutylmethyl]boronic acid (PubChem CID 176661744) has the molecular formula C28H37BBrN3O6 and a molecular weight of 602.34 g/mol. Its IUPAC name is [(R)-[[(2S)-2-[[(2S)-3-(3-bromophenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-4-methylpentanoyl]amino]-cyclobutylmethyl]boronic acid.
| Compound Name | [(R)-[[(2S)-2-[[(2S)-3-(3-bromophenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-4-methylpentanoyl]amino]-cyclobutylmethyl]boronic acid |
|---|---|
| PubChem CID | 176661744 |
| Molecular Formula | C28H37BBrN3O6 |
| Molecular Weight | 602.34 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | [(R)-[[(2S)-2-[[(2S)-3-(3-bromophenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-4-methylpentanoyl]amino]-cyclobutylmethyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc(Br)c1)NC(=O)OCc1ccccc1)C(=O)N[C@H](B(O)O)C1CCC1 |
| InChI | InChI=1S/C28H37BBrN3O6/c1-18(2)14-23(27(35)33-25(29(37)38)21-11-7-12-21)31-26(34)24(16-20-10-6-13-22(30)15-20)32-28(36)39-17-19-8-4-3-5-9-19/h3-6,8-10,13,15,18,21,23-25,37-38H,7,11-12,14,16-17H2,1-2H3,(H,31,34)(H,32,36)(H,33,35)/t23-,24-,25-/m0/s1 |
| InChIKey | QGKRCABTZKSENX-SDHOMARFSA-N |
| XLogP | 3.11 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|