C23H29BClN3O6 — CID 176661782
[1-[[2-[[(2S)-3-(2-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetyl]amino]-2-methylpropyl]boronic acid (PubChem CID 176661782) has the molecular formula C23H29BClN3O6 and a molecular weight of 489.77 g/mol. Its IUPAC name is [1-[[2-[[(2S)-3-(2-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetyl]amino]-2-methylpropyl]boronic acid.
| Compound Name | [1-[[2-[[(2S)-3-(2-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetyl]amino]-2-methylpropyl]boronic acid |
|---|---|
| PubChem CID | 176661782 |
| Molecular Formula | C23H29BClN3O6 |
| Molecular Weight | 489.77 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | [1-[[2-[[(2S)-3-(2-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetyl]amino]-2-methylpropyl]boronic acid |
| SMILES | CC(C)C(NC(=O)CNC(=O)[C@H](Cc1ccccc1Cl)NC(=O)OCc1ccccc1)B(O)O |
| InChI | InChI=1S/C23H29BClN3O6/c1-15(2)21(24(32)33)28-20(29)13-26-22(30)19(12-17-10-6-7-11-18(17)25)27-23(31)34-14-16-8-4-3-5-9-16/h3-11,15,19,21,32-33H,12-14H2,1-2H3,(H,26,30)(H,27,31)(H,28,29)/t19-,21?/m0/s1 |
| InChIKey | UHWLSJKDMBXKCI-ZQRQZVKFSA-N |
| XLogP | 1.45 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.77 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|