C36H30Cl4N2O10 — CID 67631300
2,4-bis(2,6-dichlorophenyl)-3-oxopentanedioic acid;2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid (PubChem CID 67631300) has the molecular formula C36H30Cl4N2O10 and a molecular weight of 792.45 g/mol. Its IUPAC name is 2,4-bis(2,6-dichlorophenyl)-3-oxopentanedioic acid;2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid.
| Compound Name | 2,4-bis(2,6-dichlorophenyl)-3-oxopentanedioic acid;2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 67631300 |
| Molecular Formula | C36H30Cl4N2O10 |
| Molecular Weight | 792.45 g/mol |
| Exact Mass | 790.07 |
| IUPAC Name | 2,4-bis(2,6-dichlorophenyl)-3-oxopentanedioic acid;2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid |
| SMILES | O=C(O)C(C(=O)C(C(=O)O)c1c(Cl)cccc1Cl)c1c(Cl)cccc1Cl.O=C(O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H20N2O5.C17H10Cl4O5/c22-17(23)12-20-18(24)16(11-14-7-3-1-4-8-14)21-19(25)26-13-15-9-5-2-6-10-15;18-7-3-1-4-8(19)11(7)13(16(23)24)15(22)14(17(25)26)12-9(20)5-2-6-10(12)21/h1-10,16H,11-13H2,(H,20,24)(H,21,25)(H,22,23);1-6,13-14H,(H,23,24)(H,25,26)/t16-;/m0./s1 |
| InChIKey | SUXWZGALOCSCCZ-NTISSMGPSA-N |
| XLogP | 6.63 |
| TPSA | 196.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.45 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|