C12H18F2N2 — CID 176663812
3,3-difluoroprop-1-ene;3-(2-methylpropyl)pyridin-2-amine (PubChem CID 176663812) has the molecular formula C12H18F2N2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3,3-difluoroprop-1-ene;3-(2-methylpropyl)pyridin-2-amine.
| Compound Name | 3,3-difluoroprop-1-ene;3-(2-methylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 176663812 |
| Molecular Formula | C12H18F2N2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3,3-difluoroprop-1-ene;3-(2-methylpropyl)pyridin-2-amine |
| SMILES | C=CC(F)F.CC(C)Cc1cccnc1N |
| InChI | InChI=1S/C9H14N2.C3H4F2/c1-7(2)6-8-4-3-5-11-9(8)10;1-2-3(4)5/h3-5,7H,6H2,1-2H3,(H2,10,11);2-3H,1H2 |
| InChIKey | SSAXPQGRMJVBLA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|