C24H45NO5 — CID 176664870
[6-(2,2-dimethylpropanoylamino)-9-formyloxy-2,4,4,7,7,9-hexamethyldecan-2-yl] acetate (PubChem CID 176664870) has the molecular formula C24H45NO5 and a molecular weight of 427.63 g/mol. Its IUPAC name is [6-(2,2-dimethylpropanoylamino)-9-formyloxy-2,4,4,7,7,9-hexamethyldecan-2-yl] acetate.
| Compound Name | [6-(2,2-dimethylpropanoylamino)-9-formyloxy-2,4,4,7,7,9-hexamethyldecan-2-yl] acetate |
|---|---|
| PubChem CID | 176664870 |
| Molecular Formula | C24H45NO5 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.33 |
| IUPAC Name | [6-(2,2-dimethylpropanoylamino)-9-formyloxy-2,4,4,7,7,9-hexamethyldecan-2-yl] acetate |
| SMILES | CC(=O)OC(C)(C)CC(C)(C)CC(NC(=O)C(C)(C)C)C(C)(C)CC(C)(C)OC=O |
| InChI | InChI=1S/C24H45NO5/c1-17(27)30-24(11,12)14-21(5,6)13-18(25-19(28)20(2,3)4)22(7,8)15-23(9,10)29-16-26/h16,18H,13-15H2,1-12H3,(H,25,28) |
| InChIKey | AYHVYZRDVBFODW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|