C25H34N2O7 — CID 176667070
9-tert-butyl-14-cyclopropyl-4-methoxy-5-(3-methoxypropoxy)-3-methyl-13-oxo-8-oxa-3,14-diazatricyclo[8.4.0.02,7]tetradeca-1(10),4,6,11-tetraene-12-carboxylic acid (PubChem CID 176667070) has the molecular formula C25H34N2O7 and a molecular weight of 474.55 g/mol. Its IUPAC name is 9-tert-butyl-14-cyclopropyl-4-methoxy-5-(3-methoxypropoxy)-3-methyl-13-oxo-8-oxa-3,14-diazatricyclo[8.4.0.02,7]tetradeca-1(10),4,6,11-tetraene-12-carboxylic acid.
| Compound Name | 9-tert-butyl-14-cyclopropyl-4-methoxy-5-(3-methoxypropoxy)-3-methyl-13-oxo-8-oxa-3,14-diazatricyclo[8.4.0.02,7]tetradeca-1(10),4,6,11-tetraene-12-carboxylic acid |
|---|---|
| PubChem CID | 176667070 |
| Molecular Formula | C25H34N2O7 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 9-tert-butyl-14-cyclopropyl-4-methoxy-5-(3-methoxypropoxy)-3-methyl-13-oxo-8-oxa-3,14-diazatricyclo[8.4.0.02,7]tetradeca-1(10),4,6,11-tetraene-12-carboxylic acid |
| SMILES | COCCCOC1=C(OC)N(C)C2C(=C1)OC(C(C)(C)C)c1cc(C(=O)O)c(=O)n(C3CC3)c12 |
| InChI | InChI=1S/C25H34N2O7/c1-25(2,3)21-15-12-16(24(29)30)22(28)27(14-8-9-14)19(15)20-17(34-21)13-18(23(32-6)26(20)4)33-11-7-10-31-5/h12-14,20-21H,7-11H2,1-6H3,(H,29,30) |
| InChIKey | DQPFBICALAHPPE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|