C21H22N4O — CID 176667639
1-(2,5-dimethylphenyl)-3-[4-(3-methyl-2H-indazol-5-yl)but-3-yn-2-yl]urea (PubChem CID 176667639) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[4-(3-methyl-2H-indazol-5-yl)but-3-yn-2-yl]urea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[4-(3-methyl-2H-indazol-5-yl)but-3-yn-2-yl]urea |
|---|---|
| PubChem CID | 176667639 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[4-(3-methyl-2H-indazol-5-yl)but-3-yn-2-yl]urea |
| SMILES | Cc1ccc(C)c(NC(=O)NC(C)C#Cc2ccc3n[nH]c(C)c3c2)c1 |
| InChI | InChI=1S/C21H22N4O/c1-13-5-6-14(2)20(11-13)23-21(26)22-15(3)7-8-17-9-10-19-18(12-17)16(4)24-25-19/h5-6,9-12,15H,1-4H3,(H,24,25)(H2,22,23,26) |
| InChIKey | VBNBTHNMJLPALR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|