C22H23N3O2 — CID 176667616
1-(2,5-dimethylphenyl)-3-[4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)but-3-yn-2-yl]urea (PubChem CID 176667616) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)but-3-yn-2-yl]urea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)but-3-yn-2-yl]urea |
|---|---|
| PubChem CID | 176667616 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)but-3-yn-2-yl]urea |
| SMILES | Cc1ccc(C)c(NC(=O)NC(C)C#Cc2ccc3c(c2)CCC(=O)N3)c1 |
| InChI | InChI=1S/C22H23N3O2/c1-14-4-5-15(2)20(12-14)25-22(27)23-16(3)6-7-17-8-10-19-18(13-17)9-11-21(26)24-19/h4-5,8,10,12-13,16H,9,11H2,1-3H3,(H,24,26)(H2,23,25,27) |
| InChIKey | GKLSNIMEDJULNA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|