C26H34N6O2 — CID 176668422
N-[2-[4-[(Z)-2-amino-4-iminopent-2-en-3-yl]anilino]-1-cyclohexyl-2-oxoethyl]-2-prop-2-enylpyrazole-3-carboxamide (PubChem CID 176668422) has the molecular formula C26H34N6O2 and a molecular weight of 462.60 g/mol. Its IUPAC name is N-[2-[4-[(Z)-2-amino-4-iminopent-2-en-3-yl]anilino]-1-cyclohexyl-2-oxoethyl]-2-prop-2-enylpyrazole-3-carboxamide.
| Compound Name | N-[2-[4-[(Z)-2-amino-4-iminopent-2-en-3-yl]anilino]-1-cyclohexyl-2-oxoethyl]-2-prop-2-enylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 176668422 |
| Molecular Formula | C26H34N6O2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | N-[2-[4-[(Z)-2-amino-4-iminopent-2-en-3-yl]anilino]-1-cyclohexyl-2-oxoethyl]-2-prop-2-enylpyrazole-3-carboxamide |
| SMILES | [H]/N=C(C)/C(=C(/C)N)c1ccc(NC(=O)C(NC(=O)c2ccnn2CC=C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C26H34N6O2/c1-4-16-32-22(14-15-29-32)25(33)31-24(20-8-6-5-7-9-20)26(34)30-21-12-10-19(11-13-21)23(17(2)27)18(3)28/h4,10-15,20,24,27H,1,5-9,16,28H2,2-3H3,(H,30,34)(H,31,33)/b23-18+,27-17+ |
| InChIKey | RMNNXNQTXLPKSH-ITOISGSPSA-N |
| XLogP | 4.12 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|