C32H48N6O5 — CID 177147034
N-[(1S)-2-[4-[(Z)-2-amino-4-imino-5-[2-(2-methoxyethoxy)ethoxy]pent-2-en-3-yl]anilino]-1-cycloheptyl-2-oxoethyl]-2-propan-2-ylpyrazole-3-carboxamide (PubChem CID 177147034) has the molecular formula C32H48N6O5 and a molecular weight of 596.77 g/mol. Its IUPAC name is N-[(1S)-2-[4-[(Z)-2-amino-4-imino-5-[2-(2-methoxyethoxy)ethoxy]pent-2-en-3-yl]anilino]-1-cycloheptyl-2-oxoethyl]-2-propan-2-ylpyrazole-3-carboxamide.
| Compound Name | N-[(1S)-2-[4-[(Z)-2-amino-4-imino-5-[2-(2-methoxyethoxy)ethoxy]pent-2-en-3-yl]anilino]-1-cycloheptyl-2-oxoethyl]-2-propan-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 177147034 |
| Molecular Formula | C32H48N6O5 |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.37 |
| IUPAC Name | N-[(1S)-2-[4-[(Z)-2-amino-4-imino-5-[2-(2-methoxyethoxy)ethoxy]pent-2-en-3-yl]anilino]-1-cycloheptyl-2-oxoethyl]-2-propan-2-ylpyrazole-3-carboxamide |
| SMILES | [H]/N=C(COCCOCCOC)/C(=C(/C)N)c1ccc(NC(=O)[C@@H](NC(=O)c2ccnn2C(C)C)C2CCCCCC2)cc1 |
| InChI | InChI=1S/C32H48N6O5/c1-22(2)38-28(15-16-35-38)31(39)37-30(25-9-7-5-6-8-10-25)32(40)36-26-13-11-24(12-14-26)29(23(3)33)27(34)21-43-20-19-42-18-17-41-4/h11-16,22,25,30,34H,5-10,17-21,33H2,1-4H3,(H,36,40)(H,37,39)/b29-23-,34-27+/t30-/m0/s1 |
| InChIKey | YFRXSSDQTGTKGR-QOMGMLBCSA-N |
| XLogP | 4.56 |
| TPSA | 153.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|