C40H34N2O3 — CID 176668849
methyl 4-[4-(4-tert-butylphenyl)-5-methyl-8-phenoxazin-10-ylquinolin-2-yl]benzoate (PubChem CID 176668849) has the molecular formula C40H34N2O3 and a molecular weight of 590.72 g/mol. Its IUPAC name is methyl 4-[4-(4-tert-butylphenyl)-5-methyl-8-phenoxazin-10-ylquinolin-2-yl]benzoate.
| Compound Name | methyl 4-[4-(4-tert-butylphenyl)-5-methyl-8-phenoxazin-10-ylquinolin-2-yl]benzoate |
|---|---|
| PubChem CID | 176668849 |
| Molecular Formula | C40H34N2O3 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | methyl 4-[4-(4-tert-butylphenyl)-5-methyl-8-phenoxazin-10-ylquinolin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)c3c(C)ccc(N4c5ccccc5Oc5ccccc54)c3n2)cc1 |
| InChI | InChI=1S/C40H34N2O3/c1-25-14-23-34(42-32-10-6-8-12-35(32)45-36-13-9-7-11-33(36)42)38-37(25)30(26-19-21-29(22-20-26)40(2,3)4)24-31(41-38)27-15-17-28(18-16-27)39(43)44-5/h6-24H,1-5H3 |
| InChIKey | NPINYFSNVSYWKL-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |