C36H27FN2O2S — CID 176668865
10-[4-(3,4-dimethoxyphenyl)-2-(4-fluorophenyl)-5-methylquinolin-8-yl]phenothiazine (PubChem CID 176668865) has the molecular formula C36H27FN2O2S and a molecular weight of 570.69 g/mol. Its IUPAC name is 10-[4-(3,4-dimethoxyphenyl)-2-(4-fluorophenyl)-5-methylquinolin-8-yl]phenothiazine.
| Compound Name | 10-[4-(3,4-dimethoxyphenyl)-2-(4-fluorophenyl)-5-methylquinolin-8-yl]phenothiazine |
|---|---|
| PubChem CID | 176668865 |
| Molecular Formula | C36H27FN2O2S |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | 10-[4-(3,4-dimethoxyphenyl)-2-(4-fluorophenyl)-5-methylquinolin-8-yl]phenothiazine |
| SMILES | COc1ccc(-c2cc(-c3ccc(F)cc3)nc3c(N4c5ccccc5Sc5ccccc54)ccc(C)c23)cc1OC |
| InChI | InChI=1S/C36H27FN2O2S/c1-22-12-18-30(39-28-8-4-6-10-33(28)42-34-11-7-5-9-29(34)39)36-35(22)26(24-15-19-31(40-2)32(20-24)41-3)21-27(38-36)23-13-16-25(37)17-14-23/h4-21H,1-3H3 |
| InChIKey | FERGJAVIXZRMCD-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |