C36H25F3N2O2S — CID 176668615
10-[4-(3,5-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenothiazine (PubChem CID 176668615) has the molecular formula C36H25F3N2O2S and a molecular weight of 606.67 g/mol. Its IUPAC name is 10-[4-(3,5-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenothiazine.
| Compound Name | 10-[4-(3,5-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenothiazine |
|---|---|
| PubChem CID | 176668615 |
| Molecular Formula | C36H25F3N2O2S |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.16 |
| IUPAC Name | 10-[4-(3,5-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenothiazine |
| SMILES | COc1cc(OC)cc(-c2cc(-c3ccc(C(F)(F)F)cc3)nc3c(N4c5ccccc5Sc5ccccc54)cccc23)c1 |
| InChI | InChI=1S/C36H25F3N2O2S/c1-42-25-18-23(19-26(20-25)43-2)28-21-29(22-14-16-24(17-15-22)36(37,38)39)40-35-27(28)8-7-11-32(35)41-30-9-3-5-12-33(30)44-34-13-6-4-10-31(34)41/h3-21H,1-2H3 |
| InChIKey | LOLYBNCGWYFZFS-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |