C37H27F3N2O2Se — CID 176668772
10-[4-(3,5-dimethoxyphenyl)-5-methyl-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenoselenazine (PubChem CID 176668772) has the molecular formula C37H27F3N2O2Se and a molecular weight of 667.59 g/mol. Its IUPAC name is 10-[4-(3,5-dimethoxyphenyl)-5-methyl-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenoselenazine.
| Compound Name | 10-[4-(3,5-dimethoxyphenyl)-5-methyl-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenoselenazine |
|---|---|
| PubChem CID | 176668772 |
| Molecular Formula | C37H27F3N2O2Se |
| Molecular Weight | 667.59 g/mol |
| Exact Mass | 668.12 |
| IUPAC Name | 10-[4-(3,5-dimethoxyphenyl)-5-methyl-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenoselenazine |
| SMILES | COc1cc(OC)cc(-c2cc(-c3ccc(C(F)(F)F)cc3)nc3c(N4c5ccccc5[Se]c5ccccc54)ccc(C)c23)c1 |
| InChI | InChI=1S/C37H27F3N2O2Se/c1-22-12-17-32(42-30-8-4-6-10-33(30)45-34-11-7-5-9-31(34)42)36-35(22)28(24-18-26(43-2)20-27(19-24)44-3)21-29(41-36)23-13-15-25(16-14-23)37(38,39)40/h4-21H,1-3H3 |
| InChIKey | DJTIJLDDUWDWSE-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.59 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|