C39H35IN2S — CID 176669066
10-[4-(4-tert-butylphenyl)-2-(4-iodo-6-methylcyclohexa-1,3-dien-1-yl)-5-methylquinolin-8-yl]phenothiazine (PubChem CID 176669066) has the molecular formula C39H35IN2S and a molecular weight of 690.69 g/mol. Its IUPAC name is 10-[4-(4-tert-butylphenyl)-2-(4-iodo-6-methylcyclohexa-1,3-dien-1-yl)-5-methylquinolin-8-yl]phenothiazine.
| Compound Name | 10-[4-(4-tert-butylphenyl)-2-(4-iodo-6-methylcyclohexa-1,3-dien-1-yl)-5-methylquinolin-8-yl]phenothiazine |
|---|---|
| PubChem CID | 176669066 |
| Molecular Formula | C39H35IN2S |
| Molecular Weight | 690.69 g/mol |
| Exact Mass | 690.16 |
| IUPAC Name | 10-[4-(4-tert-butylphenyl)-2-(4-iodo-6-methylcyclohexa-1,3-dien-1-yl)-5-methylquinolin-8-yl]phenothiazine |
| SMILES | Cc1ccc(N2c3ccccc3Sc3ccccc32)c2nc(C3=CC=C(I)CC3C)cc(-c3ccc(C(C)(C)C)cc3)c12 |
| InChI | InChI=1S/C39H35IN2S/c1-24-14-21-34(42-32-10-6-8-12-35(32)43-36-13-9-7-11-33(36)42)38-37(24)30(26-15-17-27(18-16-26)39(3,4)5)23-31(41-38)29-20-19-28(40)22-25(29)2/h6-21,23,25H,22H2,1-5H3 |
| InChIKey | QBHXMVNBPYVCLR-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.69 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|