C8H13N3OS — CID 176669134
tert-butyl 3-methyl-1,2,4-thiadiazole-5-carboximidate (PubChem CID 176669134) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is tert-butyl 3-methyl-1,2,4-thiadiazole-5-carboximidate.
| Compound Name | tert-butyl 3-methyl-1,2,4-thiadiazole-5-carboximidate |
|---|---|
| PubChem CID | 176669134 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | tert-butyl 3-methyl-1,2,4-thiadiazole-5-carboximidate |
| SMILES | [H]/N=C(\OC(C)(C)C)c1nc(C)ns1 |
| InChI | InChI=1S/C8H13N3OS/c1-5-10-7(13-11-5)6(9)12-8(2,3)4/h9H,1-4H3/b9-6- |
| InChIKey | YUUPGTMLPRWFNU-TWGQIWQCSA-N |
| XLogP | 1.99 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|