C59H108N2O10S2 — CID 176670595
4-[2-[2-[4-(azepan-1-yl)butanoyloxy]ethyldisulfanyl]ethoxycarbonyl-[4-[(Z,12R)-12-hydroxyoctadec-9-enoyl]oxybutyl]amino]butyl (Z,12R)-12-hydroxyoctadec-9-enoate (PubChem CID 176670595) has the molecular formula C59H108N2O10S2 and a molecular weight of 1069.65 g/mol. Its IUPAC name is 4-[2-[2-[4-(azepan-1-yl)butanoyloxy]ethyldisulfanyl]ethoxycarbonyl-[4-[(Z,12R)-12-hydroxyoctadec-9-enoyl]oxybutyl]amino]butyl (Z,12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | 4-[2-[2-[4-(azepan-1-yl)butanoyloxy]ethyldisulfanyl]ethoxycarbonyl-[4-[(Z,12R)-12-hydroxyoctadec-9-enoyl]oxybutyl]amino]butyl (Z,12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 176670595 |
| Molecular Formula | C59H108N2O10S2 |
| Molecular Weight | 1069.65 g/mol |
| Exact Mass | 1068.74 |
| IUPAC Name | 4-[2-[2-[4-(azepan-1-yl)butanoyloxy]ethyldisulfanyl]ethoxycarbonyl-[4-[(Z,12R)-12-hydroxyoctadec-9-enoyl]oxybutyl]amino]butyl (Z,12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)OCCCCN(CCCCOC(=O)CCCCCCC/C=C\C[C@H](O)CCCCCC)C(=O)OCCSSCCOC(=O)CCCN1CCCCCC1 |
| InChI | InChI=1S/C59H108N2O10S2/c1-3-5-7-23-36-54(62)38-25-17-13-9-11-15-19-27-40-56(64)68-48-33-31-46-61(59(67)71-51-53-73-72-52-50-70-58(66)42-35-45-60-43-29-21-22-30-44-60)47-32-34-49-69-57(65)41-28-20-16-12-10-14-18-26-39-55(63)37-24-8-6-4-2/h17-18,25-26,54-55,62-63H,3-16,19-24,27-53H2,1-2H3/b25-17-,26-18-/t54-,55-/m1/s1 |
| InChIKey | HZGDSOOTYRXZLZ-LETAUUMDSA-N |
| XLogP | 14.67 |
| TPSA | 152.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1069.65 |
| LogP ≤ 5 | 14.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|