C23H28N6O — CID 176670661
2-[[4-[(13-amino-7-methyl-8,10,12-triazatricyclo[7.4.0.02,6]trideca-1,6,8,10,12-pentaen-11-yl)amino]piperidin-1-yl]methyl]phenol (PubChem CID 176670661) has the molecular formula C23H28N6O and a molecular weight of 404.52 g/mol. Its IUPAC name is 2-[[4-[(13-amino-7-methyl-8,10,12-triazatricyclo[7.4.0.02,6]trideca-1,6,8,10,12-pentaen-11-yl)amino]piperidin-1-yl]methyl]phenol.
| Compound Name | 2-[[4-[(13-amino-7-methyl-8,10,12-triazatricyclo[7.4.0.02,6]trideca-1,6,8,10,12-pentaen-11-yl)amino]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 176670661 |
| Molecular Formula | C23H28N6O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 2-[[4-[(13-amino-7-methyl-8,10,12-triazatricyclo[7.4.0.02,6]trideca-1,6,8,10,12-pentaen-11-yl)amino]piperidin-1-yl]methyl]phenol |
| SMILES | Cc1nc2nc(NC3CCN(Cc4ccccc4O)CC3)nc(N)c2c2c1CCC2 |
| InChI | InChI=1S/C23H28N6O/c1-14-17-6-4-7-18(17)20-21(24)27-23(28-22(20)25-14)26-16-9-11-29(12-10-16)13-15-5-2-3-8-19(15)30/h2-3,5,8,16,30H,4,6-7,9-13H2,1H3,(H3,24,25,26,27,28) |
| InChIKey | HOVNNHRHSCSGGF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|