C22H27N7O — CID 176670935
3-[[4-[(10-amino-8-methyl-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(13),2,7,9,11-pentaen-12-yl)amino]piperidin-1-yl]methyl]-1H-pyridin-4-one (PubChem CID 176670935) has the molecular formula C22H27N7O and a molecular weight of 405.51 g/mol. Its IUPAC name is 3-[[4-[(10-amino-8-methyl-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(13),2,7,9,11-pentaen-12-yl)amino]piperidin-1-yl]methyl]-1H-pyridin-4-one.
| Compound Name | 3-[[4-[(10-amino-8-methyl-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(13),2,7,9,11-pentaen-12-yl)amino]piperidin-1-yl]methyl]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 176670935 |
| Molecular Formula | C22H27N7O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 3-[[4-[(10-amino-8-methyl-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(13),2,7,9,11-pentaen-12-yl)amino]piperidin-1-yl]methyl]-1H-pyridin-4-one |
| SMILES | Cc1c2c(nc3nc(NC4CCN(Cc5c[nH]ccc5=O)CC4)nc(N)c13)CCC2 |
| InChI | InChI=1S/C22H27N7O/c1-13-16-3-2-4-17(16)26-21-19(13)20(23)27-22(28-21)25-15-6-9-29(10-7-15)12-14-11-24-8-5-18(14)30/h5,8,11,15H,2-4,6-7,9-10,12H2,1H3,(H,24,30)(H3,23,25,26,27,28) |
| InChIKey | YOWZPBLTHLKOLQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |