C16H22N3O2P — CID 176671975
4-amino-3-[(8-phosphanyl-1,4-dioxaspiro[4.5]decan-7-yl)methylamino]benzonitrile (PubChem CID 176671975) has the molecular formula C16H22N3O2P and a molecular weight of 319.35 g/mol. Its IUPAC name is 4-amino-3-[(8-phosphanyl-1,4-dioxaspiro[4.5]decan-7-yl)methylamino]benzonitrile.
| Compound Name | 4-amino-3-[(8-phosphanyl-1,4-dioxaspiro[4.5]decan-7-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 176671975 |
| Molecular Formula | C16H22N3O2P |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 4-amino-3-[(8-phosphanyl-1,4-dioxaspiro[4.5]decan-7-yl)methylamino]benzonitrile |
| SMILES | N#Cc1ccc(N)c(NCC2CC3(CCC2P)OCCO3)c1 |
| InChI | InChI=1S/C16H22N3O2P/c17-9-11-1-2-13(18)14(7-11)19-10-12-8-16(4-3-15(12)22)20-5-6-21-16/h1-2,7,12,15,19H,3-6,8,10,18,22H2 |
| InChIKey | ROGKPEDAVMTUIZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|