C18H19ClN4O4S — CID 176672462
(4aR)-2-[[3-[(2R)-2-(4-chlorophenyl)-2-hydroxy-2-sulfanylethyl]-1,2,4-oxadiazol-5-yl]methyl]-4a,5,6,7-tetrahydro-4H-pyrrolo[1,2-c]pyrimidine-1,3-dione (PubChem CID 176672462) has the molecular formula C18H19ClN4O4S and a molecular weight of 422.89 g/mol. Its IUPAC name is (4aR)-2-[[3-[(2R)-2-(4-chlorophenyl)-2-hydroxy-2-sulfanylethyl]-1,2,4-oxadiazol-5-yl]methyl]-4a,5,6,7-tetrahydro-4H-pyrrolo[1,2-c]pyrimidine-1,3-dione.
| Compound Name | (4aR)-2-[[3-[(2R)-2-(4-chlorophenyl)-2-hydroxy-2-sulfanylethyl]-1,2,4-oxadiazol-5-yl]methyl]-4a,5,6,7-tetrahydro-4H-pyrrolo[1,2-c]pyrimidine-1,3-dione |
|---|---|
| PubChem CID | 176672462 |
| Molecular Formula | C18H19ClN4O4S |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (4aR)-2-[[3-[(2R)-2-(4-chlorophenyl)-2-hydroxy-2-sulfanylethyl]-1,2,4-oxadiazol-5-yl]methyl]-4a,5,6,7-tetrahydro-4H-pyrrolo[1,2-c]pyrimidine-1,3-dione |
| SMILES | O=C1C[C@H]2CCCN2C(=O)N1Cc1nc(C[C@@](O)(S)c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C18H19ClN4O4S/c19-12-5-3-11(4-6-12)18(26,28)9-14-20-15(27-21-14)10-23-16(24)8-13-2-1-7-22(13)17(23)25/h3-6,13,26,28H,1-2,7-10H2/t13-,18-/m1/s1 |
| InChIKey | XGOUUDPVALXMKY-FZKQIMNGSA-N |
| XLogP | 2.36 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|