C17H16ClN5O3 — CID 176672540
2-[[3-[(E)-2-(4-chlorophenyl)ethenyl]-1,2,4-oxadiazol-5-yl]methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 176672540) has the molecular formula C17H16ClN5O3 and a molecular weight of 373.80 g/mol. Its IUPAC name is 2-[[3-[(E)-2-(4-chlorophenyl)ethenyl]-1,2,4-oxadiazol-5-yl]methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | 2-[[3-[(E)-2-(4-chlorophenyl)ethenyl]-1,2,4-oxadiazol-5-yl]methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 176672540 |
| Molecular Formula | C17H16ClN5O3 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-[[3-[(E)-2-(4-chlorophenyl)ethenyl]-1,2,4-oxadiazol-5-yl]methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | O=C1C2CNCCN2C(=O)N1Cc1nc(/C=C/c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C17H16ClN5O3/c18-12-4-1-11(2-5-12)3-6-14-20-15(26-21-14)10-23-16(24)13-9-19-7-8-22(13)17(23)25/h1-6,13,19H,7-10H2/b6-3+ |
| InChIKey | QGXRFHPZLWKQOV-ZZXKWVIFSA-N |
| XLogP | 1.63 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|