C7H12N2O3 — CID 176672537
3-formyl-N-methylmorpholine-4-carboxamide (PubChem CID 176672537) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is 3-formyl-N-methylmorpholine-4-carboxamide.
| Compound Name | 3-formyl-N-methylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 176672537 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 3-formyl-N-methylmorpholine-4-carboxamide |
| SMILES | CNC(=O)N1CCOCC1C=O |
| InChI | InChI=1S/C7H12N2O3/c1-8-7(11)9-2-3-12-5-6(9)4-10/h4,6H,2-3,5H2,1H3,(H,8,11) |
| InChIKey | AQMPVTLXNGEVGN-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|