C22H24FN3O3 — CID 176672661
N-[3-(5-fluoro-3-pyridinyl)propyl]-5-(3-methyl-4-propan-2-yloxyphenyl)-1,3-oxazole-4-carboxamide (PubChem CID 176672661) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is N-[3-(5-fluoro-3-pyridinyl)propyl]-5-(3-methyl-4-propan-2-yloxyphenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-[3-(5-fluoro-3-pyridinyl)propyl]-5-(3-methyl-4-propan-2-yloxyphenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 176672661 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-[3-(5-fluoro-3-pyridinyl)propyl]-5-(3-methyl-4-propan-2-yloxyphenyl)-1,3-oxazole-4-carboxamide |
| SMILES | Cc1cc(-c2ocnc2C(=O)NCCCc2cncc(F)c2)ccc1OC(C)C |
| InChI | InChI=1S/C22H24FN3O3/c1-14(2)29-19-7-6-17(9-15(19)3)21-20(26-13-28-21)22(27)25-8-4-5-16-10-18(23)12-24-11-16/h6-7,9-14H,4-5,8H2,1-3H3,(H,25,27) |
| InChIKey | AXAUPRGJRVMUHT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|