C24H30FN3O2 — CID 176672711
ethane;N-[3-(5-fluoro-3-pyridinyl)propyl]-5-(4-methoxy-3-methylphenyl)-1,2-dihydropyridine-6-carboxamide (PubChem CID 176672711) has the molecular formula C24H30FN3O2 and a molecular weight of 411.52 g/mol. Its IUPAC name is ethane;N-[3-(5-fluoro-3-pyridinyl)propyl]-5-(4-methoxy-3-methylphenyl)-1,2-dihydropyridine-6-carboxamide.
| Compound Name | ethane;N-[3-(5-fluoro-3-pyridinyl)propyl]-5-(4-methoxy-3-methylphenyl)-1,2-dihydropyridine-6-carboxamide |
|---|---|
| PubChem CID | 176672711 |
| Molecular Formula | C24H30FN3O2 |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | ethane;N-[3-(5-fluoro-3-pyridinyl)propyl]-5-(4-methoxy-3-methylphenyl)-1,2-dihydropyridine-6-carboxamide |
| SMILES | CC.COc1ccc(C2=C(C(=O)NCCCc3cncc(F)c3)NCC=C2)cc1C |
| InChI | InChI=1S/C22H24FN3O2.C2H6/c1-15-11-17(7-8-20(15)28-2)19-6-4-9-25-21(19)22(27)26-10-3-5-16-12-18(23)14-24-13-16;1-2/h4,6-8,11-14,25H,3,5,9-10H2,1-2H3,(H,26,27);1-2H3 |
| InChIKey | MBOHMZYDAQIGTL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|