C22H34N4O3 — CID 176672776
ethane;5-(4-methoxy-3-methylphenyl)-N-[3-(1H-pyrazol-5-yl)propyl]-2,3-dihydro-1,3-oxazole-4-carboxamide (PubChem CID 176672776) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is ethane;5-(4-methoxy-3-methylphenyl)-N-[3-(1H-pyrazol-5-yl)propyl]-2,3-dihydro-1,3-oxazole-4-carboxamide.
| Compound Name | ethane;5-(4-methoxy-3-methylphenyl)-N-[3-(1H-pyrazol-5-yl)propyl]-2,3-dihydro-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 176672776 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | ethane;5-(4-methoxy-3-methylphenyl)-N-[3-(1H-pyrazol-5-yl)propyl]-2,3-dihydro-1,3-oxazole-4-carboxamide |
| SMILES | CC.CC.COc1ccc(C2=C(C(=O)NCCCc3ccn[nH]3)NCO2)cc1C |
| InChI | InChI=1S/C18H22N4O3.2C2H6/c1-12-10-13(5-6-15(12)24-2)17-16(20-11-25-17)18(23)19-8-3-4-14-7-9-21-22-14;2*1-2/h5-7,9-10,20H,3-4,8,11H2,1-2H3,(H,19,23)(H,21,22);2*1-2H3 |
| InChIKey | LQGWOALLJRYZEW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|