C38H44N6O6 — CID 176672967
N-[[4-[4-[4-[6-(dimethylamino)-2-methyl-1-oxo-2,7-naphthyridin-4-yl]-2,6-dimethoxyphenyl]piperidin-1-yl]-2-methylphenyl]methyl]-N-(2,6-dioxopiperidin-3-yl)formamide (PubChem CID 176672967) has the molecular formula C38H44N6O6 and a molecular weight of 680.81 g/mol. Its IUPAC name is N-[[4-[4-[4-[6-(dimethylamino)-2-methyl-1-oxo-2,7-naphthyridin-4-yl]-2,6-dimethoxyphenyl]piperidin-1-yl]-2-methylphenyl]methyl]-N-(2,6-dioxopiperidin-3-yl)formamide.
| Compound Name | N-[[4-[4-[4-[6-(dimethylamino)-2-methyl-1-oxo-2,7-naphthyridin-4-yl]-2,6-dimethoxyphenyl]piperidin-1-yl]-2-methylphenyl]methyl]-N-(2,6-dioxopiperidin-3-yl)formamide |
|---|---|
| PubChem CID | 176672967 |
| Molecular Formula | C38H44N6O6 |
| Molecular Weight | 680.81 g/mol |
| Exact Mass | 680.33 |
| IUPAC Name | N-[[4-[4-[4-[6-(dimethylamino)-2-methyl-1-oxo-2,7-naphthyridin-4-yl]-2,6-dimethoxyphenyl]piperidin-1-yl]-2-methylphenyl]methyl]-N-(2,6-dioxopiperidin-3-yl)formamide |
| SMILES | COc1cc(-c2cn(C)c(=O)c3cnc(N(C)C)cc23)cc(OC)c1C1CCN(c2ccc(CN(C=O)C3CCC(=O)NC3=O)c(C)c2)CC1 |
| InChI | InChI=1S/C38H44N6O6/c1-23-15-27(8-7-25(23)20-44(22-45)31-9-10-35(46)40-37(31)47)43-13-11-24(12-14-43)36-32(49-5)16-26(17-33(36)50-6)30-21-42(4)38(48)29-19-39-34(41(2)3)18-28(29)30/h7-8,15-19,21-22,24,31H,9-14,20H2,1-6H3,(H,40,46,47) |
| InChIKey | IVXCMBUXSHCRDV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.81 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|