C8H15N3O — CID 176675160
1-(1-amino-1,7-diazaspiro[3.4]octan-7-yl)ethanone (PubChem CID 176675160) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 1-(1-amino-1,7-diazaspiro[3.4]octan-7-yl)ethanone.
| Compound Name | 1-(1-amino-1,7-diazaspiro[3.4]octan-7-yl)ethanone |
|---|---|
| PubChem CID | 176675160 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 1-(1-amino-1,7-diazaspiro[3.4]octan-7-yl)ethanone |
| SMILES | CC(=O)N1CCC2(CCN2N)C1 |
| InChI | InChI=1S/C8H15N3O/c1-7(12)10-4-2-8(6-10)3-5-11(8)9/h2-6,9H2,1H3 |
| InChIKey | QDGKTFZOMDRXAG-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|